About lithium;oxolane;2,2,2-trifluoroacetate
lithium;oxolane;2,2,2-trifluoroacetate (PubChem CID 67674835) has the molecular formula C6H8F3LiO3
and a molecular weight of 192.06 g/mol. Its IUPAC name is lithium;oxolane;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | lithium;oxolane;2,2,2-trifluoroacetate |
| PubChem CID | 67674835 |
| Molecular Formula | C6H8F3LiO3 |
| Molecular Weight | 192.06 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | lithium;oxolane;2,2,2-trifluoroacetate |
| SMILES | C1CCOC1.O=C([O-])C(F)(F)F.[Li+] |
| InChI | InChI=1S/C4H8O.C2HF3O2.Li/c1-2-4-5-3-1;3-2(4,5)1(6)7;/h1-4H2;(H,6,7);/q;;+1/p-1 |
| InChIKey | IGWKSKZKNUZNRB-UHFFFAOYSA-M |
| XLogP | -2.90 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.06 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;oxolane;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;oxolane;2,2,2-trifluoroacetate?
The IUPAC name of lithium;oxolane;2,2,2-trifluoroacetate (CID 67674835) is lithium;oxolane;2,2,2-trifluoroacetate.
What is the SMILES notation for lithium;oxolane;2,2,2-trifluoroacetate?
The canonical SMILES for lithium;oxolane;2,2,2-trifluoroacetate is C1CCOC1.O=C([O-])C(F)(F)F.[Li+].
What is the InChIKey of lithium;oxolane;2,2,2-trifluoroacetate?
The InChIKey is IGWKSKZKNUZNRB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O.C2HF3O2.Li/c1-2-4-5-3-1;3-2(4,5)1(6)7;/h1-4H2;(H,6,7);/q;;+1/p-1.
What are the key properties of lithium;oxolane;2,2,2-trifluoroacetate?
lithium;oxolane;2,2,2-trifluoroacetate has a molecular weight of 192.06 g/mol, XLogP of -2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;oxolane;2,2,2-trifluoroacetate is sourced from PubChem (CID 67674835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).