C24H32N2O2S — CID 67675621
pent-3-enyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate (PubChem CID 67675621) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is pent-3-enyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate.
| Compound Name | pent-3-enyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 67675621 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | pent-3-enyl N-[3-(1,2,3,4,6,7,8,9,10,10a-decahydropyrido[1,2-a]azepin-8-yl)-1-benzothiophen-5-yl]carbamate |
| SMILES | CC=CCCOC(=O)Nc1ccc2scc(C3CCC4CCCCN4CC3)c2c1 |
| InChI | InChI=1S/C24H32N2O2S/c1-2-3-6-15-28-24(27)25-19-9-11-23-21(16-19)22(17-29-23)18-8-10-20-7-4-5-13-26(20)14-12-18/h2-3,9,11,16-18,20H,4-8,10,12-15H2,1H3,(H,25,27) |
| InChIKey | IZDGEZFVOZVRBE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|