About N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide
N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide (PubChem CID 67675773) has the molecular formula C26H33NO5S
and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide |
| PubChem CID | 67675773 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide |
| SMILES | CCCC1(CCC)CC(O)=C(C(CC)N(c2ccccc2)S(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C26H33NO5S/c1-4-17-26(18-5-2)19-23(28)24(25(29)32-26)22(6-3)27(20-13-9-7-10-14-20)33(30,31)21-15-11-8-12-16-21/h7-16,22,28H,4-6,17-19H2,1-3H3 |
| InChIKey | RGXPQDORIOIYBF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide?
The IUPAC name of N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide (CID 67675773) is N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide.
What is the SMILES notation for N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide?
The canonical SMILES for N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide is CCCC1(CCC)CC(O)=C(C(CC)N(c2ccccc2)S(=O)(=O)c2ccccc2)C(=O)O1.
What is the InChIKey of N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide?
The InChIKey is RGXPQDORIOIYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33NO5S/c1-4-17-26(18-5-2)19-23(28)24(25(29)32-26)22(6-3)27(20-13-9-7-10-14-20)33(30,31)21-15-11-8-12-16-21/h7-16,22,28H,4-6,17-19H2,1-3H3.
What are the key properties of N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide?
N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide has a molecular weight of 471.62 g/mol, XLogP of 5.76, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-hydroxy-6-oxo-2,2-dipropyl-3H-pyran-5-yl)propyl]-N-phenylbenzenesulfonamide is sourced from PubChem (CID 67675773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).