C23H24ClNO3 — CID 67676397
(1R,3S)-1-[(benzylamino)methyl]-3-phenyl-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride (PubChem CID 67676397) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is (1R,3S)-1-[(benzylamino)methyl]-3-phenyl-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride.
| Compound Name | (1R,3S)-1-[(benzylamino)methyl]-3-phenyl-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride |
|---|---|
| PubChem CID | 67676397 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (1R,3S)-1-[(benzylamino)methyl]-3-phenyl-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride |
| SMILES | Cl.Oc1ccc2c(c1O)C[C@@H](c1ccccc1)O[C@H]2CNCc1ccccc1 |
| InChI | InChI=1S/C23H23NO3.ClH/c25-20-12-11-18-19(23(20)26)13-21(17-9-5-2-6-10-17)27-22(18)15-24-14-16-7-3-1-4-8-16;/h1-12,21-22,24-26H,13-15H2;1H/t21-,22-;/m0./s1 |
| InChIKey | BTTRRRAZMOPMIY-VROPFNGYSA-N |
| XLogP | 4.66 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|