About 2-(3,5-dimethylpyrazol-1-yl)pyridine
2-(3,5-dimethylpyrazol-1-yl)pyridine (PubChem CID 676764) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)pyridine |
| PubChem CID | 676764 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)pyridine |
| SMILES | Cc1cc(C)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C10H11N3/c1-8-7-9(2)13(12-8)10-5-3-4-6-11-10/h3-7H,1-2H3 |
| InChIKey | DQJACDPPPOAZOZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)pyridine?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)pyridine (CID 676764) is 2-(3,5-dimethylpyrazol-1-yl)pyridine.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)pyridine?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)pyridine is Cc1cc(C)n(-c2ccccn2)n1.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)pyridine?
The InChIKey is DQJACDPPPOAZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-8-7-9(2)13(12-8)10-5-3-4-6-11-10/h3-7H,1-2H3.
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)pyridine?
2-(3,5-dimethylpyrazol-1-yl)pyridine has a molecular weight of 173.22 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)pyridine is sourced from PubChem (CID 676764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).