C26H37N3O2 — CID 67676505
1-[(3aS,3bS,10aR,10bS,12aS)-7,10a,12a-trimethyl-8-oxo-2,3,3a,3b,4,5,7,9,10,10b,11,12-dodecahydro-1H-indeno[5,4-a]quinolizin-1-yl]-3-phenylurea (PubChem CID 67676505) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 1-[(3aS,3bS,10aR,10bS,12aS)-7,10a,12a-trimethyl-8-oxo-2,3,3a,3b,4,5,7,9,10,10b,11,12-dodecahydro-1H-indeno[5,4-a]quinolizin-1-yl]-3-phenylurea.
| Compound Name | 1-[(3aS,3bS,10aR,10bS,12aS)-7,10a,12a-trimethyl-8-oxo-2,3,3a,3b,4,5,7,9,10,10b,11,12-dodecahydro-1H-indeno[5,4-a]quinolizin-1-yl]-3-phenylurea |
|---|---|
| PubChem CID | 67676505 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 1-[(3aS,3bS,10aR,10bS,12aS)-7,10a,12a-trimethyl-8-oxo-2,3,3a,3b,4,5,7,9,10,10b,11,12-dodecahydro-1H-indeno[5,4-a]quinolizin-1-yl]-3-phenylurea |
| SMILES | CC1C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)C(NC(=O)Nc5ccccc5)CC[C@H]4[C@@H]3CCN12 |
| InChI | InChI=1S/C26H37N3O2/c1-17-22(30)12-15-26(3)21-11-14-25(2)20(19(21)13-16-29(17)26)9-10-23(25)28-24(31)27-18-7-5-4-6-8-18/h4-8,17,19-21,23H,9-16H2,1-3H3,(H2,27,28,31)/t17?,19-,20-,21-,23?,25-,26+/m0/s1 |
| InChIKey | HUNVAYCUWZYRGO-IKNJUVGOSA-N |
| XLogP | 4.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |