C9H16N2 — CID 67676786
2,3,4,5,6-pentamethyl-1H-pyridazine (PubChem CID 67676786) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-1H-pyridazine.
| Compound Name | 2,3,4,5,6-pentamethyl-1H-pyridazine |
|---|---|
| PubChem CID | 67676786 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-1H-pyridazine |
| SMILES | CC1=C(C)C(C)=C(C)N(C)N1 |
| InChI | InChI=1S/C9H16N2/c1-6-7(2)9(4)11(5)10-8(6)3/h10H,1-5H3 |
| InChIKey | VKJNERLXQLSZRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |