C17H25NO5P+ — CID 67676919
1-[(2R,5R)-5-[(3-carboxyphenyl)methyl]morpholin-2-yl]pentyl-hydroxy-oxophosphanium (PubChem CID 67676919) has the molecular formula C17H25NO5P+ and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-[(2R,5R)-5-[(3-carboxyphenyl)methyl]morpholin-2-yl]pentyl-hydroxy-oxophosphanium.
| Compound Name | 1-[(2R,5R)-5-[(3-carboxyphenyl)methyl]morpholin-2-yl]pentyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67676919 |
| Molecular Formula | C17H25NO5P+ |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(2R,5R)-5-[(3-carboxyphenyl)methyl]morpholin-2-yl]pentyl-hydroxy-oxophosphanium |
| SMILES | CCCCC([C@H]1CN[C@H](Cc2cccc(C(=O)O)c2)CO1)[P+](=O)O |
| InChI | InChI=1S/C17H24NO5P/c1-2-3-7-16(24(21)22)15-10-18-14(11-23-15)9-12-5-4-6-13(8-12)17(19)20/h4-6,8,14-16,18H,2-3,7,9-11H2,1H3,(H-,19,20,21,22)/p+1/t14-,15-,16?/m1/s1 |
| InChIKey | RDFPAHLRAIUVDF-YGFGXBMJSA-O |
| XLogP | 2.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|