C20H31N2O6P — CID 67677056
3-[[(3R,6R)-6-[[5-acetamidopentyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid (PubChem CID 67677056) has the molecular formula C20H31N2O6P and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-[[(3R,6R)-6-[[5-acetamidopentyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3R,6R)-6-[[5-acetamidopentyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 67677056 |
| Molecular Formula | C20H31N2O6P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[[(3R,6R)-6-[[5-acetamidopentyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid |
| SMILES | CC(=O)NCCCCCP(=O)(O)C[C@H]1CN[C@H](Cc2cccc(C(=O)O)c2)CO1 |
| InChI | InChI=1S/C20H31N2O6P/c1-15(23)21-8-3-2-4-9-29(26,27)14-19-12-22-18(13-28-19)11-16-6-5-7-17(10-16)20(24)25/h5-7,10,18-19,22H,2-4,8-9,11-14H2,1H3,(H,21,23)(H,24,25)(H,26,27)/t18-,19-/m1/s1 |
| InChIKey | HDQHPLRSLVJOAC-RTBURBONSA-N |
| XLogP | 1.86 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|