C35H35N5O4 — CID 67677544
2-hydroxy-3-(naphthalen-2-ylmethylamino)-3-(1-phenylbutan-2-yl)-2-(quinoline-2-carbonylamino)butanediamide (PubChem CID 67677544) has the molecular formula C35H35N5O4 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-hydroxy-3-(naphthalen-2-ylmethylamino)-3-(1-phenylbutan-2-yl)-2-(quinoline-2-carbonylamino)butanediamide.
| Compound Name | 2-hydroxy-3-(naphthalen-2-ylmethylamino)-3-(1-phenylbutan-2-yl)-2-(quinoline-2-carbonylamino)butanediamide |
|---|---|
| PubChem CID | 67677544 |
| Molecular Formula | C35H35N5O4 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 2-hydroxy-3-(naphthalen-2-ylmethylamino)-3-(1-phenylbutan-2-yl)-2-(quinoline-2-carbonylamino)butanediamide |
| SMILES | CCC(Cc1ccccc1)C(NCc1ccc2ccccc2c1)(C(N)=O)C(O)(NC(=O)c1ccc2ccccc2n1)C(N)=O |
| InChI | InChI=1S/C35H35N5O4/c1-2-28(21-23-10-4-3-5-11-23)34(32(36)42,38-22-24-16-17-25-12-6-7-14-27(25)20-24)35(44,33(37)43)40-31(41)30-19-18-26-13-8-9-15-29(26)39-30/h3-20,28,38,44H,2,21-22H2,1H3,(H2,36,42)(H2,37,43)(H,40,41) |
| InChIKey | BYTNZJKKFIUFFC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 160.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|