About 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid
4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid (PubChem CID 67677850) has the molecular formula C20H30NO5P
and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid |
| PubChem CID | 67677850 |
| Molecular Formula | C20H30NO5P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C[C@@H]2CO[C@H](CP(=O)(O)CC3CCCCC3)CN2)cc1 |
| InChI | InChI=1S/C20H30NO5P/c22-20(23)17-8-6-15(7-9-17)10-18-12-26-19(11-21-18)14-27(24,25)13-16-4-2-1-3-5-16/h6-9,16,18-19,21H,1-5,10-14H2,(H,22,23)(H,24,25)/t18-,19+/m1/s1 |
| InChIKey | UZMKRTUUNGOOQU-MOPGFXCFSA-N |
| XLogP | 3.13 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid?
The IUPAC name of 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid (CID 67677850) is 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid.
What is the SMILES notation for 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid?
The canonical SMILES for 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid is O=C(O)c1ccc(C[C@@H]2CO[C@H](CP(=O)(O)CC3CCCCC3)CN2)cc1.
What is the InChIKey of 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid?
The InChIKey is UZMKRTUUNGOOQU-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H30NO5P/c22-20(23)17-8-6-15(7-9-17)10-18-12-26-19(11-21-18)14-27(24,25)13-16-4-2-1-3-5-16/h6-9,16,18-19,21H,1-5,10-14H2,(H,22,23)(H,24,25)/t18-,19+/m1/s1.
What are the key properties of 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid?
4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid has a molecular weight of 395.44 g/mol, XLogP of 3.13, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R,6S)-6-[[cyclohexylmethyl(hydroxy)phosphoryl]methyl]morpholin-3-yl]methyl]benzoic acid is sourced from PubChem (CID 67677850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).