C20H39BN2O3 — CID 67678247
(1R,2S,4S)-4-amino-N-tert-butyl-1-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide (PubChem CID 67678247) has the molecular formula C20H39BN2O3 and a molecular weight of 366.36 g/mol. Its IUPAC name is (1R,2S,4S)-4-amino-N-tert-butyl-1-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide.
| Compound Name | (1R,2S,4S)-4-amino-N-tert-butyl-1-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 67678247 |
| Molecular Formula | C20H39BN2O3 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | (1R,2S,4S)-4-amino-N-tert-butyl-1-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@]1(C)C[C@@H](N)C[C@@H]1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H39BN2O3/c1-17(2,3)23-16(24)20(8)13-15(22)12-14(20)10-9-11-21-25-18(4,5)19(6,7)26-21/h14-15H,9-13,22H2,1-8H3,(H,23,24)/t14-,15-,20+/m0/s1 |
| InChIKey | RQNJHPUUIITTDR-AUSJPIAWSA-N |
| XLogP | 3.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|