C15H27NO — CID 67678251
(1R,2S,4S)-N-tert-butyl-1,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxamide (PubChem CID 67678251) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (1R,2S,4S)-N-tert-butyl-1,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxamide.
| Compound Name | (1R,2S,4S)-N-tert-butyl-1,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 67678251 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (1R,2S,4S)-N-tert-butyl-1,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxamide |
| SMILES | C=CC[C@H]1C[C@H](C)C[C@@]1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-7-8-12-9-11(2)10-15(12,6)13(17)16-14(3,4)5/h7,11-12H,1,8-10H2,2-6H3,(H,16,17)/t11-,12-,15+/m0/s1 |
| InChIKey | QUFWCUQGHCKEHP-SLEUVZQESA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|