C28H36FN5O2 — CID 67678347
2-ethyl-N-[3-fluoro-4-[4-[phenyl-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]phenyl]butanamide (PubChem CID 67678347) has the molecular formula C28H36FN5O2 and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-ethyl-N-[3-fluoro-4-[4-[phenyl-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]phenyl]butanamide.
| Compound Name | 2-ethyl-N-[3-fluoro-4-[4-[phenyl-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 67678347 |
| Molecular Formula | C28H36FN5O2 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 2-ethyl-N-[3-fluoro-4-[4-[phenyl-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]phenyl]butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(c3ccccc3)c3nc(C(C)C)no3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H36FN5O2/c1-5-20(6-2)27(35)30-22-12-13-24(23(29)18-22)33-14-16-34(17-15-33)25(21-10-8-7-9-11-21)28-31-26(19(3)4)32-36-28/h7-13,18-20,25H,5-6,14-17H2,1-4H3,(H,30,35) |
| InChIKey | IWJDLSFTYLLWCQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|