About (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine
(8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine (PubChem CID 67678531) has the molecular formula C7H8IN3
and a molecular weight of 261.07 g/mol. Its IUPAC name is (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine |
| PubChem CID | 67678531 |
| Molecular Formula | C7H8IN3 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine |
| SMILES | IC12N=CC=C[C@@H]1N=CCN2 |
| InChI | InChI=1S/C7H8IN3/c8-7-6(2-1-3-10-7)9-4-5-11-7/h1-4,6,11H,5H2/t6-,7?/m0/s1 |
| InChIKey | ZMEKIGRKBXVROA-PKPIPKONSA-N |
| XLogP | 0.76 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine?
The IUPAC name of (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine (CID 67678531) is (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine.
What is the SMILES notation for (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine?
The canonical SMILES for (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine is IC12N=CC=C[C@@H]1N=CCN2.
What is the InChIKey of (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine?
The InChIKey is ZMEKIGRKBXVROA-PKPIPKONSA-N. The full InChI is InChI=1S/C7H8IN3/c8-7-6(2-1-3-10-7)9-4-5-11-7/h1-4,6,11H,5H2/t6-,7?/m0/s1.
What are the key properties of (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine?
(8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine has a molecular weight of 261.07 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8aS)-4a-iodo-4,8a-dihydro-3H-pyrido[2,3-b]pyrazine is sourced from PubChem (CID 67678531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).