C40H68O10 — CID 67678650
17,26-diethoxy-8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31,32-hexaoxahexacyclo[22.3.1.11,4.15,8.19,12.113,17]dotriacontan-20-one (PubChem CID 67678650) has the molecular formula C40H68O10 and a molecular weight of 708.97 g/mol. Its IUPAC name is 17,26-diethoxy-8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31,32-hexaoxahexacyclo[22.3.1.11,4.15,8.19,12.113,17]dotriacontan-20-one.
| Compound Name | 17,26-diethoxy-8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31,32-hexaoxahexacyclo[22.3.1.11,4.15,8.19,12.113,17]dotriacontan-20-one |
|---|---|
| PubChem CID | 67678650 |
| Molecular Formula | C40H68O10 |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.48 |
| IUPAC Name | 17,26-diethoxy-8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31,32-hexaoxahexacyclo[22.3.1.11,4.15,8.19,12.113,17]dotriacontan-20-one |
| SMILES | CCOC1CC23CCC(C)(O2)C2CCC(CC)(O2)C2OC(CC2C)C2OC(OCC)(COC(=O)C(C)C(OC)C(C)C(O3)C1C)C(C)CC2C |
| InChI | InChI=1S/C40H68O10/c1-12-38-16-15-31(47-38)37(10)17-18-39(50-37)21-30(43-13-2)26(7)34(48-39)27(8)33(42-11)28(9)36(41)44-22-40(45-14-3)25(6)19-23(4)32(49-40)29-20-24(5)35(38)46-29/h23-35H,12-22H2,1-11H3 |
| InChIKey | XICMQOYUMMUUKP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|