C36H56O10 — CID 67678703
8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31-pentaoxapentacyclo[22.3.1.11,4.15,8.19,12]hentriacontane-13,17,20,26-tetrone (PubChem CID 67678703) has the molecular formula C36H56O10 and a molecular weight of 648.83 g/mol. Its IUPAC name is 8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31-pentaoxapentacyclo[22.3.1.11,4.15,8.19,12]hentriacontane-13,17,20,26-tetrone.
| Compound Name | 8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31-pentaoxapentacyclo[22.3.1.11,4.15,8.19,12]hentriacontane-13,17,20,26-tetrone |
|---|---|
| PubChem CID | 67678703 |
| Molecular Formula | C36H56O10 |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | 8-ethyl-22-methoxy-4,10,14,16,21,23,25-heptamethyl-19,28,29,30,31-pentaoxapentacyclo[22.3.1.11,4.15,8.19,12]hentriacontane-13,17,20,26-tetrone |
| SMILES | CCC12CCC(O1)C1(C)CCC3(CC(=O)C(C)C(O3)C(C)C(OC)C(C)C(=O)OCC(=O)C(C)CC(C)C(=O)C3CC(C)C2O3)O1 |
| InChI | InChI=1S/C36H56O10/c1-10-35-12-11-28(44-35)34(8)13-14-36(46-34)17-25(37)22(5)31(45-36)23(6)30(41-9)24(7)33(40)42-18-26(38)19(2)15-20(3)29(39)27-16-21(4)32(35)43-27/h19-24,27-28,30-32H,10-18H2,1-9H3 |
| InChIKey | SBALNMTYGYHQPW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|