About N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide
N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 67678738) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide |
| PubChem CID | 67678738 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC=CC(N)C1O |
| InChI | InChI=1S/C8H12N2O2/c1-5(11)10-7-4-2-3-6(9)8(7)12/h2-4,6,8,12H,9H2,1H3,(H,10,11) |
| InChIKey | DWSZTBLEFGHWTH-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide?
The IUPAC name of N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide (CID 67678738) is N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide.
What is the SMILES notation for N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide?
The canonical SMILES for N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide is CC(=O)NC1=CC=CC(N)C1O.
What is the InChIKey of N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide?
The InChIKey is DWSZTBLEFGHWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5(11)10-7-4-2-3-6(9)8(7)12/h2-4,6,8,12H,9H2,1H3,(H,10,11).
What are the key properties of N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide?
N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide has a molecular weight of 168.20 g/mol, XLogP of -0.74, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-6-hydroxycyclohexa-1,3-dien-1-yl)acetamide is sourced from PubChem (CID 67678738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).