About methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate
methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate (PubChem CID 67678767) has the molecular formula C13H12BrN3O3S
and a molecular weight of 370.23 g/mol. Its IUPAC name is methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate |
| PubChem CID | 67678767 |
| Molecular Formula | C13H12BrN3O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate |
| SMILES | COC(=O)C(=CO)N(C)c1nc(-c2ccc(Br)cc2)ns1 |
| InChI | InChI=1S/C13H12BrN3O3S/c1-17(10(7-18)12(19)20-2)13-15-11(16-21-13)8-3-5-9(14)6-4-8/h3-7,18H,1-2H3 |
| InChIKey | UHSBOHXDWRIMPY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate?
The IUPAC name of methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate (CID 67678767) is methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate.
What is the SMILES notation for methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate?
The canonical SMILES for methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate is COC(=O)C(=CO)N(C)c1nc(-c2ccc(Br)cc2)ns1.
What is the InChIKey of methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate?
The InChIKey is UHSBOHXDWRIMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN3O3S/c1-17(10(7-18)12(19)20-2)13-15-11(16-21-13)8-3-5-9(14)6-4-8/h3-7,18H,1-2H3.
What are the key properties of methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate?
methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate has a molecular weight of 370.23 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[3-(4-bromophenyl)-1,2,4-thiadiazol-5-yl]-methylamino]-3-hydroxyprop-2-enoate is sourced from PubChem (CID 67678767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).