About 1,2-ditert-butyl-2,3-dihydropyrrole
1,2-ditert-butyl-2,3-dihydropyrrole (PubChem CID 67678989) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 1,2-ditert-butyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1,2-ditert-butyl-2,3-dihydropyrrole |
| PubChem CID | 67678989 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1,2-ditert-butyl-2,3-dihydropyrrole |
| SMILES | CC(C)(C)C1CC=CN1C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-11(2,3)10-8-7-9-13(10)12(4,5)6/h7,9-10H,8H2,1-6H3 |
| InChIKey | UEZSBCWZFAVHSZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-ditert-butyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-ditert-butyl-2,3-dihydropyrrole?
The IUPAC name of 1,2-ditert-butyl-2,3-dihydropyrrole (CID 67678989) is 1,2-ditert-butyl-2,3-dihydropyrrole.
What is the SMILES notation for 1,2-ditert-butyl-2,3-dihydropyrrole?
The canonical SMILES for 1,2-ditert-butyl-2,3-dihydropyrrole is CC(C)(C)C1CC=CN1C(C)(C)C.
What is the InChIKey of 1,2-ditert-butyl-2,3-dihydropyrrole?
The InChIKey is UEZSBCWZFAVHSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-11(2,3)10-8-7-9-13(10)12(4,5)6/h7,9-10H,8H2,1-6H3.
What are the key properties of 1,2-ditert-butyl-2,3-dihydropyrrole?
1,2-ditert-butyl-2,3-dihydropyrrole has a molecular weight of 181.32 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-ditert-butyl-2,3-dihydropyrrole is sourced from PubChem (CID 67678989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).