About (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol
(1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol (PubChem CID 67679794) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol.
Molecular Properties
| Compound Name | (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol |
| PubChem CID | 67679794 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol |
| SMILES | OCCC1CC2CCC1C2.O[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C9H16O.C7H12O/c10-4-3-9-6-7-1-2-8(9)5-7;8-7-4-5-1-2-6(7)3-5/h7-10H,1-6H2;5-8H,1-4H2/t;5-,6+,7-/m.0/s1 |
| InChIKey | KKHLZVIDXVILMI-LPXHZEAVSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol?
The IUPAC name of (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol (CID 67679794) is (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol.
What is the SMILES notation for (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol?
The canonical SMILES for (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol is OCCC1CC2CCC1C2.O[C@H]1C[C@H]2CC[C@@H]1C2.
What is the InChIKey of (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol?
The InChIKey is KKHLZVIDXVILMI-LPXHZEAVSA-N. The full InChI is InChI=1S/C9H16O.C7H12O/c10-4-3-9-6-7-1-2-8(9)5-7;8-7-4-5-1-2-6(7)3-5/h7-10H,1-6H2;5-8H,1-4H2/t;5-,6+,7-/m.0/s1.
What are the key properties of (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol?
(1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol has a molecular weight of 252.40 g/mol, XLogP of 2.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol;2-(2-bicyclo[2.2.1]heptanyl)ethanol is sourced from PubChem (CID 67679794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).