About 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane
4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane (PubChem CID 67679889) has the molecular formula C22H28O7S
and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane |
| PubChem CID | 67679889 |
| Molecular Formula | C22H28O7S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane |
| SMILES | C1CCC(OC2CCCCO2)OC1.O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10O4S.C10H18O3/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h1-8,13-14H;9-10H,1-8H2 |
| InChIKey | PRHYCTMNOFRVKQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane?
The IUPAC name of 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane (CID 67679889) is 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane.
What is the SMILES notation for 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane?
The canonical SMILES for 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane is C1CCC(OC2CCCCO2)OC1.O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane?
The InChIKey is PRHYCTMNOFRVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4S.C10H18O3/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h1-8,13-14H;9-10H,1-8H2.
What are the key properties of 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane?
4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane has a molecular weight of 436.53 g/mol, XLogP of 3.99, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)sulfonylphenol;2-(oxan-2-yloxy)oxane is sourced from PubChem (CID 67679889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).