C21H30NO+ — CID 67680118
(1R,17R)-17-(cyclopropylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 67680118) has the molecular formula C21H30NO+ and a molecular weight of 312.48 g/mol. Its IUPAC name is (1R,17R)-17-(cyclopropylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,17R)-17-(cyclopropylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 67680118 |
| Molecular Formula | C21H30NO+ |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (1R,17R)-17-(cyclopropylmethyl)-17-methyl-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23CCCCC2C1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C21H29NO/c1-22(14-15-5-6-15)11-10-21-9-3-2-4-18(21)20(22)12-16-7-8-17(23)13-19(16)21/h7-8,13,15,18,20H,2-6,9-12,14H2,1H3/p+1/t18?,20?,21-,22-/m1/s1 |
| InChIKey | YOOGQFUBRLMUDX-QZRMGYTESA-O |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|