C24H33N3O2 — CID 67680253
3-[4-(2-methoxyphenyl)piperazin-1-yl]-4,4-dimethyl-2-phenylpentanamide (PubChem CID 67680253) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazin-1-yl]-4,4-dimethyl-2-phenylpentanamide.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-4,4-dimethyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 67680253 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-4,4-dimethyl-2-phenylpentanamide |
| SMILES | COc1ccccc1N1CCN(C(C(C(N)=O)c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-24(2,3)22(21(23(25)28)18-10-6-5-7-11-18)27-16-14-26(15-17-27)19-12-8-9-13-20(19)29-4/h5-13,21-22H,14-17H2,1-4H3,(H2,25,28) |
| InChIKey | BRAYHNCELQMPTB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |