About 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one
4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one (PubChem CID 67680583) has the molecular formula C9H13F2N3O4
and a molecular weight of 265.22 g/mol. Its IUPAC name is 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
| PubChem CID | 67680583 |
| Molecular Formula | C9H13F2N3O4 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(C(OCCO)C(F)(F)CO)c(=O)n1 |
| InChI | InChI=1S/C9H13F2N3O4/c10-9(11,5-16)7(18-4-3-15)14-2-1-6(12)13-8(14)17/h1-2,7,15-16H,3-5H2,(H2,12,13,17) |
| InChIKey | CHDJIXYUCHQRMU-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one (CID 67680583) is 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one is Nc1ccn(C(OCCO)C(F)(F)CO)c(=O)n1.
What is the InChIKey of 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one?
The InChIKey is CHDJIXYUCHQRMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O4/c10-9(11,5-16)7(18-4-3-15)14-2-1-6(12)13-8(14)17/h1-2,7,15-16H,3-5H2,(H2,12,13,17).
What are the key properties of 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one?
4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one has a molecular weight of 265.22 g/mol, XLogP of -1.04, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[2,2-difluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one is sourced from PubChem (CID 67680583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).