About (2R)-2-methyl-2,5-dihydropyrrol-1-amine
(2R)-2-methyl-2,5-dihydropyrrol-1-amine (PubChem CID 67681007) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is (2R)-2-methyl-2,5-dihydropyrrol-1-amine.
Molecular Properties
| Compound Name | (2R)-2-methyl-2,5-dihydropyrrol-1-amine |
| PubChem CID | 67681007 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | (2R)-2-methyl-2,5-dihydropyrrol-1-amine |
| SMILES | C[C@@H]1C=CCN1N |
| InChI | InChI=1S/C5H10N2/c1-5-3-2-4-7(5)6/h2-3,5H,4,6H2,1H3/t5-/m1/s1 |
| InChIKey | WQNRTKRVKZYDDY-RXMQYKEDSA-N |
| XLogP | 0.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methyl-2,5-dihydropyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-2,5-dihydropyrrol-1-amine?
The IUPAC name of (2R)-2-methyl-2,5-dihydropyrrol-1-amine (CID 67681007) is (2R)-2-methyl-2,5-dihydropyrrol-1-amine.
What is the SMILES notation for (2R)-2-methyl-2,5-dihydropyrrol-1-amine?
The canonical SMILES for (2R)-2-methyl-2,5-dihydropyrrol-1-amine is C[C@@H]1C=CCN1N.
What is the InChIKey of (2R)-2-methyl-2,5-dihydropyrrol-1-amine?
The InChIKey is WQNRTKRVKZYDDY-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H10N2/c1-5-3-2-4-7(5)6/h2-3,5H,4,6H2,1H3/t5-/m1/s1.
What are the key properties of (2R)-2-methyl-2,5-dihydropyrrol-1-amine?
(2R)-2-methyl-2,5-dihydropyrrol-1-amine has a molecular weight of 98.15 g/mol, XLogP of 0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-2,5-dihydropyrrol-1-amine is sourced from PubChem (CID 67681007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).