About (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine
(2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine (PubChem CID 67681789) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine |
| PubChem CID | 67681789 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine |
| SMILES | C[C@@H]1CC(COC(F)F)CN1C |
| InChI | InChI=1S/C8H15F2NO/c1-6-3-7(4-11(6)2)5-12-8(9)10/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | GXGGNIQWBNKQPJ-ULUSZKPHSA-N |
| XLogP | 1.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine?
The IUPAC name of (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine (CID 67681789) is (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine.
What is the SMILES notation for (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine?
The canonical SMILES for (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine is C[C@@H]1CC(COC(F)F)CN1C.
What is the InChIKey of (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine?
The InChIKey is GXGGNIQWBNKQPJ-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-6-3-7(4-11(6)2)5-12-8(9)10/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine?
(2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine has a molecular weight of 179.21 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(difluoromethoxymethyl)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 67681789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).