C32H42N2O6S — CID 67681794
1-[5-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]pentylsulfonyl]imidazolidin-2-one (PubChem CID 67681794) has the molecular formula C32H42N2O6S and a molecular weight of 582.76 g/mol. Its IUPAC name is 1-[5-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]pentylsulfonyl]imidazolidin-2-one.
| Compound Name | 1-[5-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]pentylsulfonyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 67681794 |
| Molecular Formula | C32H42N2O6S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 1-[5-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]pentylsulfonyl]imidazolidin-2-one |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCS(=O)(=O)N4CCNC4=O)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C32H42N2O6S/c1-32-20-27(30-25-12-8-23(35)19-22(25)7-11-26(30)28(32)13-14-29(32)36)21-5-9-24(10-6-21)40-17-3-2-4-18-41(38,39)34-16-15-33-31(34)37/h5-6,8-10,12,19,26-30,35-36H,2-4,7,11,13-18,20H2,1H3,(H,33,37)/t26-,27+,28-,29-,30+,32-/m0/s1 |
| InChIKey | AWZVWBPRYIKBJZ-LHFWKWSXSA-N |
| XLogP | 4.91 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|