C17H25NO6 — CID 67681906
tert-butyl (2S)-3-(2-hydroxyethoxy)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 67681906) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2-hydroxyethoxy)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-(2-hydroxyethoxy)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 67681906 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl (2S)-3-(2-hydroxyethoxy)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](COCCO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO6/c1-17(2,3)24-15(20)14(12-22-10-9-19)18-16(21)23-11-13-7-5-4-6-8-13/h4-8,14,19H,9-12H2,1-3H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | ISMJGVDACMKKBW-AWEZNQCLSA-N |
| XLogP | 1.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|