C25H30BN4O4 — CID 67681946
CID 67681946 (PubChem CID 67681946) has the molecular formula C25H30BN4O4 and a molecular weight of 461.35 g/mol.
| Compound Name | CID 67681946 |
|---|---|
| PubChem CID | 67681946 |
| Molecular Formula | C25H30BN4O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc2cc(-c3cnc([C@@H]4C[C@H](O)CN4C(=O)C(NC(=O)OC)C(C)C)[nH]3)ccc2c1 |
| InChI | InChI=1S/C25H30BN4O4/c1-14(2)22(29-25(33)34-4)24(32)30-13-19(31)11-21(30)23-27-12-20(28-23)17-6-5-16-10-18(26-3)8-7-15(16)9-17/h5-10,12,14,19,21-22,31H,11,13H2,1-4H3,(H,27,28)(H,29,33)/t19-,21-,22?/m0/s1 |
| InChIKey | PWJBVRLJHHHZEZ-QUCQDJGISA-N |
| XLogP | 2.62 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|