C21H34O3 — CID 67682870
1-[(8R,9R,10S,13S,14S)-17,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone (PubChem CID 67682870) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-[(8R,9R,10S,13S,14S)-17,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone.
| Compound Name | 1-[(8R,9R,10S,13S,14S)-17,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone |
|---|---|
| PubChem CID | 67682870 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-[(8R,9R,10S,13S,14S)-17,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone |
| SMILES | CC(=O)C1CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@@]2(C)[C@H]3CCC2(O)O)C1 |
| InChI | InChI=1S/C21H34O3/c1-13(22)14-6-9-19(2)15(12-14)4-5-16-17(19)7-10-20(3)18(16)8-11-21(20,23)24/h14-18,23-24H,4-12H2,1-3H3/t14?,15?,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | HPVLAPKSIWTMEI-NHNPDYMASA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|