C9H4Cl3FN2 — CID 67683191
4-chloro-5-(3,5-dichloro-4-fluorophenyl)-1H-pyrazole (PubChem CID 67683191) has the molecular formula C9H4Cl3FN2 and a molecular weight of 265.50 g/mol. Its IUPAC name is 4-chloro-5-(3,5-dichloro-4-fluorophenyl)-1H-pyrazole.
| Compound Name | 4-chloro-5-(3,5-dichloro-4-fluorophenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 67683191 |
| Molecular Formula | C9H4Cl3FN2 |
| Molecular Weight | 265.50 g/mol |
| Exact Mass | 263.94 |
| IUPAC Name | 4-chloro-5-(3,5-dichloro-4-fluorophenyl)-1H-pyrazole |
| SMILES | Fc1c(Cl)cc(-c2[nH]ncc2Cl)cc1Cl |
| InChI | InChI=1S/C9H4Cl3FN2/c10-5-1-4(2-6(11)8(5)13)9-7(12)3-14-15-9/h1-3H,(H,14,15) |
| InChIKey | BLALRQDWEZFWDM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|