About 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride
3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride (PubChem CID 67683242) has the molecular formula C7H13ClN2
and a molecular weight of 160.65 g/mol. Its IUPAC name is 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride.
Molecular Properties
| Compound Name | 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride |
| PubChem CID | 67683242 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride |
| SMILES | C=CCC1=[N+](C)CCN1.[Cl-] |
| InChI | InChI=1S/C7H12N2.ClH/c1-3-4-7-8-5-6-9(7)2;/h3H,1,4-6H2,2H3;1H |
| InChIKey | HLRMRVBAXOQXGT-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride?
The IUPAC name of 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride (CID 67683242) is 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride.
What is the SMILES notation for 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride?
The canonical SMILES for 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride is C=CCC1=[N+](C)CCN1.[Cl-].
What is the InChIKey of 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride?
The InChIKey is HLRMRVBAXOQXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.ClH/c1-3-4-7-8-5-6-9(7)2;/h3H,1,4-6H2,2H3;1H.
What are the key properties of 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride?
3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride has a molecular weight of 160.65 g/mol, XLogP of -2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-prop-2-enyl-4,5-dihydro-1H-imidazol-3-ium chloride is sourced from PubChem (CID 67683242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).