About pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one
pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 67683306) has the molecular formula C12H12N4OS
and a molecular weight of 260.32 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| PubChem CID | 67683306 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | O=C1C[C@@H]2SCC=CN12.c1cnc2ccnn2c1 |
| InChI | InChI=1S/C6H5N3.C6H7NOS/c1-3-7-6-2-4-8-9(6)5-1;8-5-4-6-7(5)2-1-3-9-6/h1-5H;1-2,6H,3-4H2/t;6-/m.0/s1 |
| InChIKey | UGUYJRYIZOYQQP-ZCMDIHMWSA-N |
| XLogP | 1.53 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The IUPAC name of pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (CID 67683306) is pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
What is the SMILES notation for pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The canonical SMILES for pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one is O=C1C[C@@H]2SCC=CN12.c1cnc2ccnn2c1.
What is the InChIKey of pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The InChIKey is UGUYJRYIZOYQQP-ZCMDIHMWSA-N. The full InChI is InChI=1S/C6H5N3.C6H7NOS/c1-3-7-6-2-4-8-9(6)5-1;8-5-4-6-7(5)2-1-3-9-6/h1-5H;1-2,6H,3-4H2/t;6-/m.0/s1.
What are the key properties of pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one has a molecular weight of 260.32 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyrimidine;(6S)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one is sourced from PubChem (CID 67683306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).