C12H16N2 — CID 67683528
3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-8-ylmethanamine (PubChem CID 67683528) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-8-ylmethanamine.
| Compound Name | 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-8-ylmethanamine |
|---|---|
| PubChem CID | 67683528 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-8-ylmethanamine |
| SMILES | NCC1=CC=CC2NC3CC=CC3C12 |
| InChI | InChI=1S/C12H16N2/c13-7-8-3-1-6-11-12(8)9-4-2-5-10(9)14-11/h1-4,6,9-12,14H,5,7,13H2 |
| InChIKey | YMOMLJFUBXAYJA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|