C12H14N2 — CID 67683529
1,2,3,3a-tetrahydrocyclopenta[b]indol-1-ylmethanamine (PubChem CID 67683529) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,2,3,3a-tetrahydrocyclopenta[b]indol-1-ylmethanamine.
| Compound Name | 1,2,3,3a-tetrahydrocyclopenta[b]indol-1-ylmethanamine |
|---|---|
| PubChem CID | 67683529 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,2,3,3a-tetrahydrocyclopenta[b]indol-1-ylmethanamine |
| SMILES | NCC1CCC2N=c3ccccc3=C12 |
| InChI | InChI=1S/C12H14N2/c13-7-8-5-6-11-12(8)9-3-1-2-4-10(9)14-11/h1-4,8,11H,5-7,13H2 |
| InChIKey | KAWOJWLFHTXFHM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |