C10H18N2 — CID 67684576
1,2,3,4,4a,5-hexahydroquinoline;methanamine (PubChem CID 67684576) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydroquinoline;methanamine.
| Compound Name | 1,2,3,4,4a,5-hexahydroquinoline;methanamine |
|---|---|
| PubChem CID | 67684576 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydroquinoline;methanamine |
| SMILES | C1=CCC2CCCNC2=C1.CN |
| InChI | InChI=1S/C9H13N.CH5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h1-2,6,8,10H,3-5,7H2;2H2,1H3 |
| InChIKey | HKALDTVKFJRHTL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |