About 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol
4-[bis(prop-2-enyl)amino]-2,6-dibromophenol (PubChem CID 67684652) has the molecular formula C12H13Br2NO
and a molecular weight of 347.05 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol.
Molecular Properties
| Compound Name | 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol |
| PubChem CID | 67684652 |
| Molecular Formula | C12H13Br2NO |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol |
| SMILES | C=CCN(CC=C)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C12H13Br2NO/c1-3-5-15(6-4-2)9-7-10(13)12(16)11(14)8-9/h3-4,7-8,16H,1-2,5-6H2 |
| InChIKey | RVTSQNDOIXCNDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol?
The IUPAC name of 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol (CID 67684652) is 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol.
What is the SMILES notation for 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol?
The canonical SMILES for 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol is C=CCN(CC=C)c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol?
The InChIKey is RVTSQNDOIXCNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br2NO/c1-3-5-15(6-4-2)9-7-10(13)12(16)11(14)8-9/h3-4,7-8,16H,1-2,5-6H2.
What are the key properties of 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol?
4-[bis(prop-2-enyl)amino]-2,6-dibromophenol has a molecular weight of 347.05 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(prop-2-enyl)amino]-2,6-dibromophenol is sourced from PubChem (CID 67684652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).