C24H25NO5S — CID 67684770
methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 67684770) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 67684770 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-18-8-14-22(15-9-18)31(27,28)25-23(24(26)29-2)16-19-10-12-21(13-11-19)30-17-20-6-4-3-5-7-20/h3-15,23,25H,16-17H2,1-2H3/t23-/m0/s1 |
| InChIKey | CFQFKSCYVRTOCO-QHCPKHFHSA-N |
| XLogP | 3.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |