About 3,4-bis(prop-2-enyl)-1,2,4-triazole
3,4-bis(prop-2-enyl)-1,2,4-triazole (PubChem CID 67685086) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3,4-bis(prop-2-enyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 3,4-bis(prop-2-enyl)-1,2,4-triazole |
| PubChem CID | 67685086 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3,4-bis(prop-2-enyl)-1,2,4-triazole |
| SMILES | C=CCc1nncn1CC=C |
| InChI | InChI=1S/C8H11N3/c1-3-5-8-10-9-7-11(8)6-4-2/h3-4,7H,1-2,5-6H2 |
| InChIKey | MWOJFIDREMDCFU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(prop-2-enyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(prop-2-enyl)-1,2,4-triazole?
The IUPAC name of 3,4-bis(prop-2-enyl)-1,2,4-triazole (CID 67685086) is 3,4-bis(prop-2-enyl)-1,2,4-triazole.
What is the SMILES notation for 3,4-bis(prop-2-enyl)-1,2,4-triazole?
The canonical SMILES for 3,4-bis(prop-2-enyl)-1,2,4-triazole is C=CCc1nncn1CC=C.
What is the InChIKey of 3,4-bis(prop-2-enyl)-1,2,4-triazole?
The InChIKey is MWOJFIDREMDCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-3-5-8-10-9-7-11(8)6-4-2/h3-4,7H,1-2,5-6H2.
What are the key properties of 3,4-bis(prop-2-enyl)-1,2,4-triazole?
3,4-bis(prop-2-enyl)-1,2,4-triazole has a molecular weight of 149.20 g/mol, XLogP of 1.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(prop-2-enyl)-1,2,4-triazole is sourced from PubChem (CID 67685086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).