C21H29NO4 — CID 67685390
methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-2,4-dioxocyclohexane-1-carboxylate (PubChem CID 67685390) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-2,4-dioxocyclohexane-1-carboxylate.
| Compound Name | methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-2,4-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67685390 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl (5R)-5-[(3aS,7aS)-4-(cyanomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-2,4-dioxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C[C@](C)(C2CC[C@]3(C)CCC[C@H]3C2CC#N)C(=O)CC1=O |
| InChI | InChI=1S/C21H29NO4/c1-20-8-4-5-15(20)13(7-10-22)16(6-9-20)21(2)12-14(19(25)26-3)17(23)11-18(21)24/h13-16H,4-9,11-12H2,1-3H3/t13?,14?,15-,16?,20-,21+/m0/s1 |
| InChIKey | IVHKLDPOACYWTC-RXBREWIOSA-N |
| XLogP | 3.46 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|