C11H9ClN2OS2 — CID 676855
2-chloro-5-methylsulfanyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 676855) has the molecular formula C11H9ClN2OS2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-chloro-5-methylsulfanyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-5-methylsulfanyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 676855 |
| Molecular Formula | C11H9ClN2OS2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2-chloro-5-methylsulfanyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C11H9ClN2OS2/c1-16-7-2-3-9(12)8(6-7)10(15)14-11-13-4-5-17-11/h2-6H,1H3,(H,13,14,15) |
| InChIKey | IBSDYJWYXHNYHM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |