C27H29N5O3 — CID 67686467
tert-butyl N-[1-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]indazol-5-yl]carbamate (PubChem CID 67686467) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]indazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]indazol-5-yl]carbamate |
|---|---|
| PubChem CID | 67686467 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | tert-butyl N-[1-[4-[[4-(dimethylamino)benzoyl]amino]phenyl]indazol-5-yl]carbamate |
| SMILES | CN(C)c1ccc(C(=O)Nc2ccc(-n3ncc4cc(NC(=O)OC(C)(C)C)ccc43)cc2)cc1 |
| InChI | InChI=1S/C27H29N5O3/c1-27(2,3)35-26(34)30-21-10-15-24-19(16-21)17-28-32(24)23-13-8-20(9-14-23)29-25(33)18-6-11-22(12-7-18)31(4)5/h6-17H,1-5H3,(H,29,33)(H,30,34) |
| InChIKey | YVBKLHHRXRRTOM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |