C28H26N6O4 — CID 67686962
4-[6-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 67686962) has the molecular formula C28H26N6O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is 4-[6-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[6-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 67686962 |
| Molecular Formula | C28H26N6O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 4-[6-[(3-methyl-1,2,4-oxadiazol-5-yl)methoxy]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1noc(COc2ccc3nc(-c4ccc(C(=O)Nc5ccc(N6CCOCC6)cc5)cc4)[nH]c3c2)n1 |
| InChI | InChI=1S/C28H26N6O4/c1-18-29-26(38-33-18)17-37-23-10-11-24-25(16-23)32-27(31-24)19-2-4-20(5-3-19)28(35)30-21-6-8-22(9-7-21)34-12-14-36-15-13-34/h2-11,16H,12-15,17H2,1H3,(H,30,35)(H,31,32) |
| InChIKey | ODJHASKPYMKYLW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|