About 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione
9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione (PubChem CID 67686995) has the molecular formula C16H24N4O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione |
| PubChem CID | 67686995 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione |
| SMILES | CCCC1CCC(CCC)C1n1cnc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C16H24N4O2/c1-3-5-10-7-8-11(6-4-2)13(10)20-9-17-12-14(20)18-16(22)19-15(12)21/h9-11,13H,3-8H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | DAJYOQURLFVVDR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione?
The IUPAC name of 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione (CID 67686995) is 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione.
What is the SMILES notation for 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione?
The canonical SMILES for 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione is CCCC1CCC(CCC)C1n1cnc2c(=O)[nH]c(=O)[nH]c21.
What is the InChIKey of 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione?
The InChIKey is DAJYOQURLFVVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2/c1-3-5-10-7-8-11(6-4-2)13(10)20-9-17-12-14(20)18-16(22)19-15(12)21/h9-11,13H,3-8H2,1-2H3,(H2,18,19,21,22).
What are the key properties of 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione?
9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione has a molecular weight of 304.39 g/mol, XLogP of 2.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,5-dipropylcyclopentyl)-3H-purine-2,6-dione is sourced from PubChem (CID 67686995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).