About 1-phenylmethoxy-2H-1,3,5-triazine
1-phenylmethoxy-2H-1,3,5-triazine (PubChem CID 67687700) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-phenylmethoxy-2H-1,3,5-triazine.
Molecular Properties
| Compound Name | 1-phenylmethoxy-2H-1,3,5-triazine |
| PubChem CID | 67687700 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 1-phenylmethoxy-2H-1,3,5-triazine |
| SMILES | C1=NC=NCN1OCc1ccccc1 |
| InChI | InChI=1S/C10H11N3O/c1-2-4-10(5-3-1)6-14-13-8-11-7-12-9-13/h1-5,7-8H,6,9H2 |
| InChIKey | OJRVCRQVXJWTPC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylmethoxy-2H-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylmethoxy-2H-1,3,5-triazine?
The IUPAC name of 1-phenylmethoxy-2H-1,3,5-triazine (CID 67687700) is 1-phenylmethoxy-2H-1,3,5-triazine.
What is the SMILES notation for 1-phenylmethoxy-2H-1,3,5-triazine?
The canonical SMILES for 1-phenylmethoxy-2H-1,3,5-triazine is C1=NC=NCN1OCc1ccccc1.
What is the InChIKey of 1-phenylmethoxy-2H-1,3,5-triazine?
The InChIKey is OJRVCRQVXJWTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-2-4-10(5-3-1)6-14-13-8-11-7-12-9-13/h1-5,7-8H,6,9H2.
What are the key properties of 1-phenylmethoxy-2H-1,3,5-triazine?
1-phenylmethoxy-2H-1,3,5-triazine has a molecular weight of 189.22 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylmethoxy-2H-1,3,5-triazine is sourced from PubChem (CID 67687700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).