About 3-phenylmethoxy-2,6-dihydro-1H-triazine
3-phenylmethoxy-2,6-dihydro-1H-triazine (PubChem CID 67687704) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-phenylmethoxy-2,6-dihydro-1H-triazine.
Molecular Properties
| Compound Name | 3-phenylmethoxy-2,6-dihydro-1H-triazine |
| PubChem CID | 67687704 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-phenylmethoxy-2,6-dihydro-1H-triazine |
| SMILES | C1=CN(OCc2ccccc2)NNC1 |
| InChI | InChI=1S/C10H13N3O/c1-2-5-10(6-3-1)9-14-13-8-4-7-11-12-13/h1-6,8,11-12H,7,9H2 |
| InChIKey | XQOSNNBZFVAXIV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenylmethoxy-2,6-dihydro-1H-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxy-2,6-dihydro-1H-triazine?
The IUPAC name of 3-phenylmethoxy-2,6-dihydro-1H-triazine (CID 67687704) is 3-phenylmethoxy-2,6-dihydro-1H-triazine.
What is the SMILES notation for 3-phenylmethoxy-2,6-dihydro-1H-triazine?
The canonical SMILES for 3-phenylmethoxy-2,6-dihydro-1H-triazine is C1=CN(OCc2ccccc2)NNC1.
What is the InChIKey of 3-phenylmethoxy-2,6-dihydro-1H-triazine?
The InChIKey is XQOSNNBZFVAXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-2-5-10(6-3-1)9-14-13-8-4-7-11-12-13/h1-6,8,11-12H,7,9H2.
What are the key properties of 3-phenylmethoxy-2,6-dihydro-1H-triazine?
3-phenylmethoxy-2,6-dihydro-1H-triazine has a molecular weight of 191.23 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxy-2,6-dihydro-1H-triazine is sourced from PubChem (CID 67687704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).