About 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one
3-hydroxy-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 67687788) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 67687788 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(O)CO2 |
| InChI | InChI=1S/C10H10O3/c1-6-2-3-9-7(4-6)10(12)8(11)5-13-9/h2-4,8,11H,5H2,1H3 |
| InChIKey | JYOPNZZCSDHHIF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one (CID 67687788) is 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one is Cc1ccc2c(c1)C(=O)C(O)CO2.
What is the InChIKey of 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one?
The InChIKey is JYOPNZZCSDHHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-6-2-3-9-7(4-6)10(12)8(11)5-13-9/h2-4,8,11H,5H2,1H3.
What are the key properties of 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one?
3-hydroxy-6-methyl-2,3-dihydrochromen-4-one has a molecular weight of 178.19 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 67687788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).