About 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one
3-hydroxy-6-propyl-2,3-dihydrochromen-4-one (PubChem CID 67687821) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one |
| PubChem CID | 67687821 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one |
| SMILES | CCCc1ccc2c(c1)C(=O)C(O)CO2 |
| InChI | InChI=1S/C12H14O3/c1-2-3-8-4-5-11-9(6-8)12(14)10(13)7-15-11/h4-6,10,13H,2-3,7H2,1H3 |
| InChIKey | HKUJJMPUSACZTM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one?
The IUPAC name of 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one (CID 67687821) is 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one is CCCc1ccc2c(c1)C(=O)C(O)CO2.
What is the InChIKey of 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one?
The InChIKey is HKUJJMPUSACZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-2-3-8-4-5-11-9(6-8)12(14)10(13)7-15-11/h4-6,10,13H,2-3,7H2,1H3.
What are the key properties of 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one?
3-hydroxy-6-propyl-2,3-dihydrochromen-4-one has a molecular weight of 206.24 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-propyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 67687821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).