About 1-fluorooctylcyclohexane
1-fluorooctylcyclohexane (PubChem CID 67688316) has the molecular formula C14H27F
and a molecular weight of 214.37 g/mol. Its IUPAC name is 1-fluorooctylcyclohexane.
Molecular Properties
| Compound Name | 1-fluorooctylcyclohexane |
| PubChem CID | 67688316 |
| Molecular Formula | C14H27F |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.21 |
| IUPAC Name | 1-fluorooctylcyclohexane |
| SMILES | CCCCCCCC(F)C1CCCCC1 |
| InChI | InChI=1S/C14H27F/c1-2-3-4-5-9-12-14(15)13-10-7-6-8-11-13/h13-14H,2-12H2,1H3 |
| InChIKey | XYNDTAIBGWVCDT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorooctylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorooctylcyclohexane?
The IUPAC name of 1-fluorooctylcyclohexane (CID 67688316) is 1-fluorooctylcyclohexane.
What is the SMILES notation for 1-fluorooctylcyclohexane?
The canonical SMILES for 1-fluorooctylcyclohexane is CCCCCCCC(F)C1CCCCC1.
What is the InChIKey of 1-fluorooctylcyclohexane?
The InChIKey is XYNDTAIBGWVCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F/c1-2-3-4-5-9-12-14(15)13-10-7-6-8-11-13/h13-14H,2-12H2,1H3.
What are the key properties of 1-fluorooctylcyclohexane?
1-fluorooctylcyclohexane has a molecular weight of 214.37 g/mol, XLogP of 5.27, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorooctylcyclohexane is sourced from PubChem (CID 67688316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).